About 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide
3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 55491975) has the molecular formula C22H17F3N4O2
and a molecular weight of 426.40 g/mol. Its IUPAC name is 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide |
| PubChem CID | 55491975 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCc1ncc(-c2ccccc2)o1)Nc1cc(C(F)(F)F)ccc1-n1cccn1 |
| InChI | InChI=1S/C22H17F3N4O2/c23-22(24,25)16-7-8-18(29-12-4-11-27-29)17(13-16)28-20(30)9-10-21-26-14-19(31-21)15-5-2-1-3-6-15/h1-8,11-14H,9-10H2,(H,28,30) |
| InChIKey | JJJCWHDXPYAYGB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide?
The IUPAC name of 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide (CID 55491975) is 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide.
What is the SMILES notation for 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide?
The canonical SMILES for 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide is O=C(CCc1ncc(-c2ccccc2)o1)Nc1cc(C(F)(F)F)ccc1-n1cccn1.
What is the InChIKey of 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide?
The InChIKey is JJJCWHDXPYAYGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N4O2/c23-22(24,25)16-7-8-18(29-12-4-11-27-29)17(13-16)28-20(30)9-10-21-26-14-19(31-21)15-5-2-1-3-6-15/h1-8,11-14H,9-10H2,(H,28,30).
What are the key properties of 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide?
3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide has a molecular weight of 426.40 g/mol, XLogP of 5.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-phenyl-1,3-oxazol-2-yl)-N-[2-pyrazol-1-yl-5-(trifluoromethyl)phenyl]propanamide is sourced from PubChem (CID 55491975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).