C22H22N4O3S — CID 55492292
8-(3-phenothiazin-10-ylpropanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 55492292) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 8-(3-phenothiazin-10-ylpropanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(3-phenothiazin-10-ylpropanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 55492292 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 8-(3-phenothiazin-10-ylpropanoyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)CCN3c4ccccc4Sc4ccccc43)CC2)N1 |
| InChI | InChI=1S/C22H22N4O3S/c27-19(25-13-10-22(11-14-25)20(28)23-21(29)24-22)9-12-26-15-5-1-3-7-17(15)30-18-8-4-2-6-16(18)26/h1-8H,9-14H2,(H2,23,24,28,29) |
| InChIKey | IDMZUMLVTFBLAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|