C23H29ClN4O2 — CID 55492554
3-acetamido-3-(4-chlorophenyl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide (PubChem CID 55492554) has the molecular formula C23H29ClN4O2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 3-acetamido-3-(4-chlorophenyl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide.
| Compound Name | 3-acetamido-3-(4-chlorophenyl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 55492554 |
| Molecular Formula | C23H29ClN4O2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-acetamido-3-(4-chlorophenyl)-N-[3-methyl-4-(4-methylpiperazin-1-yl)phenyl]propanamide |
| SMILES | CC(=O)NC(CC(=O)Nc1ccc(N2CCN(C)CC2)c(C)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN4O2/c1-16-14-20(8-9-22(16)28-12-10-27(3)11-13-28)26-23(30)15-21(25-17(2)29)18-4-6-19(24)7-5-18/h4-9,14,21H,10-13,15H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | OSXOTXAJIVUMRE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|