C22H19F2N3O2S — CID 55494609
2,4-difluoro-N-[2-oxo-2-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]ethyl]benzamide (PubChem CID 55494609) has the molecular formula C22H19F2N3O2S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-oxo-2-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-oxo-2-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55494609 |
| Molecular Formula | C22H19F2N3O2S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2,4-difluoro-N-[2-oxo-2-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]amino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1F)Nc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| InChI | InChI=1S/C22H19F2N3O2S/c23-16-7-8-17(18(24)10-16)21(29)25-11-20(28)27-22-26-19(12-30-22)15-6-5-13-3-1-2-4-14(13)9-15/h5-10,12H,1-4,11H2,(H,25,29)(H,26,27,28) |
| InChIKey | TUNYGESXOOWPQP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |