C18H25N3O4S2 — CID 55497682
[1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate (PubChem CID 55497682) has the molecular formula C18H25N3O4S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate.
| Compound Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
|---|---|
| PubChem CID | 55497682 |
| Molecular Formula | C18H25N3O4S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | [1-[cyclohexyl(1,3-thiazol-2-yl)amino]-1-oxopropan-2-yl] 3-(2-oxo-1,3-thiazolidin-3-yl)propanoate |
| SMILES | CC(OC(=O)CCN1CCSC1=O)C(=O)N(c1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C18H25N3O4S2/c1-13(25-15(22)7-9-20-10-12-27-18(20)24)16(23)21(17-19-8-11-26-17)14-5-3-2-4-6-14/h8,11,13-14H,2-7,9-10,12H2,1H3 |
| InChIKey | PCNAJJNVOJORAB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|