C17H19N7O3 — CID 55497955
2-(4-methylanilino)-N'-[2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetyl]acetohydrazide (PubChem CID 55497955) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is 2-(4-methylanilino)-N'-[2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetyl]acetohydrazide.
| Compound Name | 2-(4-methylanilino)-N'-[2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 55497955 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-(4-methylanilino)-N'-[2-(1-methyl-4-oxopyrazolo[5,4-d]pyrimidin-5-yl)acetyl]acetohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)Cn2cnc3c(cnn3C)c2=O)cc1 |
| InChI | InChI=1S/C17H19N7O3/c1-11-3-5-12(6-4-11)18-8-14(25)21-22-15(26)9-24-10-19-16-13(17(24)27)7-20-23(16)2/h3-7,10,18H,8-9H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | XIOYWNDALOXPNN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 122.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|