C25H27FN4O2 — CID 55498022
[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[1-(4-fluorobenzoyl)piperidin-4-yl]methanone (PubChem CID 55498022) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[1-(4-fluorobenzoyl)piperidin-4-yl]methanone.
| Compound Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[1-(4-fluorobenzoyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55498022 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)piperidin-1-yl]-[1-(4-fluorobenzoyl)piperidin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC(C(=O)N2CCCC(c3nc4ccccc4[nH]3)C2)CC1 |
| InChI | InChI=1S/C25H27FN4O2/c26-20-9-7-17(8-10-20)24(31)29-14-11-18(12-15-29)25(32)30-13-3-4-19(16-30)23-27-21-5-1-2-6-22(21)28-23/h1-2,5-10,18-19H,3-4,11-16H2,(H,27,28) |
| InChIKey | HFBLOJFUIGJCLW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |