C22H24N4O4S2 — CID 55498032
2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 55498032) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55498032 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)Nc1ccc(Sc2nccn2C)cc1 |
| InChI | InChI=1S/C22H24N4O4S2/c1-16-3-8-19(32(28,29)26-11-13-30-14-12-26)15-20(16)21(27)24-17-4-6-18(7-5-17)31-22-23-9-10-25(22)2/h3-10,15H,11-14H2,1-2H3,(H,24,27) |
| InChIKey | NMFYLKHFJQCQHN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |