C20H16F3N3O3 — CID 55500082
3-(1-methylidene-3-oxoisoindol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 55500082) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 3-(1-methylidene-3-oxoisoindol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | 3-(1-methylidene-3-oxoisoindol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 55500082 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 3-(1-methylidene-3-oxoisoindol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | C=C1c2ccccc2C(=O)N1CCC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H16F3N3O3/c1-11-12-4-2-3-5-13(12)20(29)26(11)9-8-16(27)24-10-17(28)25-15-7-6-14(21)18(22)19(15)23/h2-7H,1,8-10H2,(H,24,27)(H,25,28) |
| InChIKey | FPSVNLFEGFLMHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|