C23H22N4OS — CID 55500881
1,3-dimethyl-6-phenyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55500881) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is 1,3-dimethyl-6-phenyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 1,3-dimethyl-6-phenyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55500881 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1,3-dimethyl-6-phenyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)c1cc(-c2ccccc2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C23H22N4OS/c1-4-12-27(15-18-11-8-13-29-18)23(28)19-14-20(17-9-6-5-7-10-17)24-22-21(19)16(2)25-26(22)3/h4-11,13-14H,1,12,15H2,2-3H3 |
| InChIKey | CUEPMHUGLBDOIR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|