C22H22ClN5O4 — CID 55500924
4-(4-chloro-2-nitrophenoxy)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide (PubChem CID 55500924) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55500924 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nnc2n1CCCCC2)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H22ClN5O4/c23-16-7-10-19(18(14-16)28(30)31)32-17-8-5-15(6-9-17)22(29)24-12-11-21-26-25-20-4-2-1-3-13-27(20)21/h5-10,14H,1-4,11-13H2,(H,24,29) |
| InChIKey | SEFYIFSSXPWGOZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|