About 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide
5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide (PubChem CID 55501236) has the molecular formula C21H18N4O3S
and a molecular weight of 406.47 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide |
| PubChem CID | 55501236 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)nc1)c1ccc(-c2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C21H18N4O3S/c26-20(23-14-5-8-19(22-13-14)25-9-11-27-12-10-25)16-6-7-17(28-16)21-24-15-3-1-2-4-18(15)29-21/h1-8,13H,9-12H2,(H,23,26) |
| InChIKey | NOXQPWVIRRLDGJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide?
The IUPAC name of 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide (CID 55501236) is 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide.
What is the SMILES notation for 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide?
The canonical SMILES for 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide is O=C(Nc1ccc(N2CCOCC2)nc1)c1ccc(-c2nc3ccccc3s2)o1.
What is the InChIKey of 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide?
The InChIKey is NOXQPWVIRRLDGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4O3S/c26-20(23-14-5-8-19(22-13-14)25-9-11-27-12-10-25)16-6-7-17(28-16)21-24-15-3-1-2-4-18(15)29-21/h1-8,13H,9-12H2,(H,23,26).
What are the key properties of 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide?
5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide has a molecular weight of 406.47 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzothiazol-2-yl)-N-(6-morpholin-4-yl-3-pyridinyl)furan-2-carboxamide is sourced from PubChem (CID 55501236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).