C23H27N5O4S — CID 55501355
4-[(2-methoxyphenyl)sulfamoyl]-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide (PubChem CID 55501355) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)sulfamoyl]-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide.
| Compound Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 55501355 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 4-[(2-methoxyphenyl)sulfamoyl]-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(C(=O)NCCc2nnc3n2CCCCC3)cc1 |
| InChI | InChI=1S/C23H27N5O4S/c1-32-20-8-5-4-7-19(20)27-33(30,31)18-12-10-17(11-13-18)23(29)24-15-14-22-26-25-21-9-3-2-6-16-28(21)22/h4-5,7-8,10-13,27H,2-3,6,9,14-16H2,1H3,(H,24,29) |
| InChIKey | OZIRXFOFXNUDPI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |