C21H20ClN5O4 — CID 55501872
[4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(3-methyl-4-nitrophenyl)methanone (PubChem CID 55501872) has the molecular formula C21H20ClN5O4 and a molecular weight of 441.88 g/mol. Its IUPAC name is [4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(3-methyl-4-nitrophenyl)methanone.
| Compound Name | [4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(3-methyl-4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 55501872 |
| Molecular Formula | C21H20ClN5O4 |
| Molecular Weight | 441.88 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [4-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(3-methyl-4-nitrophenyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(Cc3nc(-c4ccc(Cl)cc4)no3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H20ClN5O4/c1-14-12-16(4-7-18(14)27(29)30)21(28)26-10-8-25(9-11-26)13-19-23-20(24-31-19)15-2-5-17(22)6-3-15/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | HZGUIYBMNNCZEV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|