C20H18F2N4O3S — CID 55502477
N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 55502477) has the molecular formula C20H18F2N4O3S and a molecular weight of 432.45 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 55502477 |
| Molecular Formula | C20H18F2N4O3S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | CNC(=O)C(NC(=O)CCn1c(=S)[nH]c2ccccc2c1=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H18F2N4O3S/c1-23-18(28)17(11-6-7-13(21)14(22)10-11)25-16(27)8-9-26-19(29)12-4-2-3-5-15(12)24-20(26)30/h2-7,10,17H,8-9H2,1H3,(H,23,28)(H,24,30)(H,25,27) |
| InChIKey | CHTFPFXHGDOBDU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|