C22H23F3N4O3S — CID 55502941
3-(diethylsulfamoyl)-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]benzamide (PubChem CID 55502941) has the molecular formula C22H23F3N4O3S and a molecular weight of 480.51 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 55502941 |
| Molecular Formula | C22H23F3N4O3S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2cc(C)nn2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C22H23F3N4O3S/c1-4-28(5-2)33(31,32)19-11-6-8-16(13-19)21(30)26-20-12-15(3)27-29(20)18-10-7-9-17(14-18)22(23,24)25/h6-14H,4-5H2,1-3H3,(H,26,30) |
| InChIKey | YEQPQNKZGSQFAJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |