C23H27N3O5S — CID 55505577
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate (PubChem CID 55505577) has the molecular formula C23H27N3O5S and a molecular weight of 457.55 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55505577 |
| Molecular Formula | C23H27N3O5S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-4-methylsulfanylbutanoate |
| SMILES | CSCCC(C(=O)OCc1cc(=O)n2cc(C)ccc2n1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C23H27N3O5S/c1-14-7-8-19-24-15(11-20(27)25(19)12-14)13-31-23(30)18(9-10-32-2)26-21(28)16-5-3-4-6-17(16)22(26)29/h7-8,11-12,16-18H,3-6,9-10,13H2,1-2H3 |
| InChIKey | TXPMQWWOTGHAOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|