C22H23N5O3S — CID 55505616
2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide (PubChem CID 55505616) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide.
| Compound Name | 2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 55505616 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]-N-[2-(1-phenylpyrazol-4-yl)ethyl]acetamide |
| SMILES | CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NCCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H23N5O3S/c1-31(29,30)16-21-25-19-9-5-6-10-20(19)26(21)15-22(28)23-12-11-17-13-24-27(14-17)18-7-3-2-4-8-18/h2-10,13-14H,11-12,15-16H2,1H3,(H,23,28) |
| InChIKey | SHNWVEJKUOJJQX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |