C23H22FN5O2S — CID 55507314
6-(2,5-dimethylthiophen-3-yl)-N'-(4-fluorobenzoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 55507314) has the molecular formula C23H22FN5O2S and a molecular weight of 451.53 g/mol. Its IUPAC name is 6-(2,5-dimethylthiophen-3-yl)-N'-(4-fluorobenzoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | 6-(2,5-dimethylthiophen-3-yl)-N'-(4-fluorobenzoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 55507314 |
| Molecular Formula | C23H22FN5O2S |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 6-(2,5-dimethylthiophen-3-yl)-N'-(4-fluorobenzoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1cc(-c2cc(C(=O)NNC(=O)c3ccc(F)cc3)c3cnn(C(C)C)c3n2)c(C)s1 |
| InChI | InChI=1S/C23H22FN5O2S/c1-12(2)29-21-19(11-25-29)18(10-20(26-21)17-9-13(3)32-14(17)4)23(31)28-27-22(30)15-5-7-16(24)8-6-15/h5-12H,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | LHMKXTZCLXNVCF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|