C21H27N5O3S — CID 55508097
N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-(2-oxo-1,3-benzoxazol-3-yl)propanamide (PubChem CID 55508097) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-(2-oxo-1,3-benzoxazol-3-yl)propanamide.
| Compound Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 55508097 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-[3-(4-cyclopentyl-5-methylsulfanyl-1,2,4-triazol-3-yl)propyl]-2-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
| SMILES | CSc1nnc(CCCNC(=O)C(C)n2c(=O)oc3ccccc32)n1C1CCCC1 |
| InChI | InChI=1S/C21H27N5O3S/c1-14(25-16-10-5-6-11-17(16)29-21(25)28)19(27)22-13-7-12-18-23-24-20(30-2)26(18)15-8-3-4-9-15/h5-6,10-11,14-15H,3-4,7-9,12-13H2,1-2H3,(H,22,27) |
| InChIKey | CMZYFWXZHWIJNZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|