C20H23FN2O3S2 — CID 55508288
1-acetyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 55508288) has the molecular formula C20H23FN2O3S2 and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-acetyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55508288 |
| Molecular Formula | C20H23FN2O3S2 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-acetyl-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1c2ccc(S(=O)(=O)NCCSCc3ccccc3F)cc2CC1C |
| InChI | InChI=1S/C20H23FN2O3S2/c1-14-11-17-12-18(7-8-20(17)23(14)15(2)24)28(25,26)22-9-10-27-13-16-5-3-4-6-19(16)21/h3-8,12,14,22H,9-11,13H2,1-2H3 |
| InChIKey | UEDSIQXVYAJHSH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|