C22H30N4O4 — CID 55510281
2-methyl-N-[4-[[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]propanamide (PubChem CID 55510281) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-methyl-N-[4-[[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 55510281 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-methyl-N-[4-[[[2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]methyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(CNC(=O)CN2C(=O)NC3(CCCCC3C)C2=O)cc1 |
| InChI | InChI=1S/C22H30N4O4/c1-14(2)19(28)24-17-9-7-16(8-10-17)12-23-18(27)13-26-20(29)22(25-21(26)30)11-5-4-6-15(22)3/h7-10,14-15H,4-6,11-13H2,1-3H3,(H,23,27)(H,24,28)(H,25,30) |
| InChIKey | YEXYHJIAJPELGR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|