C19H18ClN3O5S — CID 55511411
N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide (PubChem CID 55511411) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 55511411 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-2-[3-(2-ethoxyphenyl)-2,4,5-trioxoimidazolidin-1-yl]-N-methylacetamide |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(CC(=O)N(C)Cc2ccc(Cl)s2)C1=O |
| InChI | InChI=1S/C19H18ClN3O5S/c1-3-28-14-7-5-4-6-13(14)23-18(26)17(25)22(19(23)27)11-16(24)21(2)10-12-8-9-15(20)29-12/h4-9H,3,10-11H2,1-2H3 |
| InChIKey | MACQOJGMHAIIOL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|