C17H21N3O4S2 — CID 55512031
3-N-(1-benzylpyrrolidin-3-yl)benzene-1,3-disulfonamide (PubChem CID 55512031) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 3-N-(1-benzylpyrrolidin-3-yl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(1-benzylpyrrolidin-3-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 55512031 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-N-(1-benzylpyrrolidin-3-yl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NC2CCN(Cc3ccccc3)C2)c1 |
| InChI | InChI=1S/C17H21N3O4S2/c18-25(21,22)16-7-4-8-17(11-16)26(23,24)19-15-9-10-20(13-15)12-14-5-2-1-3-6-14/h1-8,11,15,19H,9-10,12-13H2,(H2,18,21,22) |
| InChIKey | NRYQPNIKMORIPR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |