About [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate
[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate (PubChem CID 55512514) has the molecular formula C18H15FN2O5
and a molecular weight of 358.33 g/mol. Its IUPAC name is [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate.
Molecular Properties
| Compound Name | [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate |
| PubChem CID | 55512514 |
| Molecular Formula | C18H15FN2O5 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCc2nc(-c3ccc(C)c(F)c3)no2)c1O |
| InChI | InChI=1S/C18H15FN2O5/c1-10-6-7-11(8-13(10)19)17-20-15(26-21-17)9-25-18(23)12-4-3-5-14(24-2)16(12)22/h3-8,22H,9H2,1-2H3 |
| InChIKey | ZZYMOWNJDLCOPL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate?
The IUPAC name of [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate (CID 55512514) is [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate.
What is the SMILES notation for [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate?
The canonical SMILES for [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate is COc1cccc(C(=O)OCc2nc(-c3ccc(C)c(F)c3)no2)c1O.
What is the InChIKey of [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate?
The InChIKey is ZZYMOWNJDLCOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O5/c1-10-6-7-11(8-13(10)19)17-20-15(26-21-17)9-25-18(23)12-4-3-5-14(24-2)16(12)22/h3-8,22H,9H2,1-2H3.
What are the key properties of [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate?
[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate has a molecular weight of 358.33 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-hydroxy-3-methoxybenzoate is sourced from PubChem (CID 55512514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).