C14H8F2N2O5S — CID 55512724
(2,4-difluorophenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate (PubChem CID 55512724) has the molecular formula C14H8F2N2O5S and a molecular weight of 354.29 g/mol. Its IUPAC name is (2,4-difluorophenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate.
| Compound Name | (2,4-difluorophenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate |
|---|---|
| PubChem CID | 55512724 |
| Molecular Formula | C14H8F2N2O5S |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (2,4-difluorophenyl) 2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonate |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)Oc3ccc(F)cc3F)cc2[nH]c1=O |
| InChI | InChI=1S/C14H8F2N2O5S/c15-7-1-4-12(9(16)5-7)23-24(21,22)8-2-3-10-11(6-8)18-14(20)13(19)17-10/h1-6H,(H,17,19)(H,18,20) |
| InChIKey | WPSXGCYITMIPLJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|