C20H22N4O6 — CID 55513345
diethyl 2-[[6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl]amino]propanedioate (PubChem CID 55513345) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is diethyl 2-[[6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl]amino]propanedioate.
| Compound Name | diethyl 2-[[6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl]amino]propanedioate |
|---|---|
| PubChem CID | 55513345 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | diethyl 2-[[6-(furan-2-yl)-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carbonyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1cc(-c2ccco2)nc2c1c(C)nn2C)C(=O)OCC |
| InChI | InChI=1S/C20H22N4O6/c1-5-28-19(26)16(20(27)29-6-2)22-18(25)12-10-13(14-8-7-9-30-14)21-17-15(12)11(3)23-24(17)4/h7-10,16H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | XAQGUSPRHBYCCR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|