C19H16ClNO — CID 55514323
1-(4-chlorophenyl)-N-(3-ethynylphenyl)cyclobutane-1-carboxamide (PubChem CID 55514323) has the molecular formula C19H16ClNO and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-ethynylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-ethynylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 55514323 |
| Molecular Formula | C19H16ClNO |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-ethynylphenyl)cyclobutane-1-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2(c3ccc(Cl)cc3)CCC2)c1 |
| InChI | InChI=1S/C19H16ClNO/c1-2-14-5-3-6-17(13-14)21-18(22)19(11-4-12-19)15-7-9-16(20)10-8-15/h1,3,5-10,13H,4,11-12H2,(H,21,22) |
| InChIKey | KEIBHSCOWXXSIQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|