C25H34N4O6 — CID 55514605
methyl 5-morpholin-4-yl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate (PubChem CID 55514605) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl 5-morpholin-4-yl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate.
| Compound Name | methyl 5-morpholin-4-yl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55514605 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | methyl 5-morpholin-4-yl-2-[[2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(N2CCOCC2)ccc1NC(=O)CN1C(=O)NC2(CC(C)CC(C)(C)C2)C1=O |
| InChI | InChI=1S/C25H34N4O6/c1-16-12-24(2,3)15-25(13-16)22(32)29(23(33)27-25)14-20(30)26-19-6-5-17(11-18(19)21(31)34-4)28-7-9-35-10-8-28/h5-6,11,16H,7-10,12-15H2,1-4H3,(H,26,30)(H,27,33) |
| InChIKey | XLAUICSAYUYSTD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|