C23H16ClN5OS — CID 55515066
2-chloro-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]quinoline-4-carboxamide (PubChem CID 55515066) has the molecular formula C23H16ClN5OS and a molecular weight of 445.94 g/mol. Its IUPAC name is 2-chloro-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]quinoline-4-carboxamide.
| Compound Name | 2-chloro-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55515066 |
| Molecular Formula | C23H16ClN5OS |
| Molecular Weight | 445.94 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-chloro-N-[5-(1-methylimidazol-2-yl)-4-phenyl-1,3-thiazol-2-yl]quinoline-4-carboxamide |
| SMILES | Cn1ccnc1-c1sc(NC(=O)c2cc(Cl)nc3ccccc23)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H16ClN5OS/c1-29-12-11-25-21(29)20-19(14-7-3-2-4-8-14)27-23(31-20)28-22(30)16-13-18(24)26-17-10-6-5-9-15(16)17/h2-13H,1H3,(H,27,28,30) |
| InChIKey | SYVMYTOEYSCYKM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.94 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|