C29H32N4O3 — CID 55518864
N-[3-[[1-(2-anilino-2-oxoethyl)piperidin-4-yl]amino]-3-oxo-1-phenylpropyl]benzamide (PubChem CID 55518864) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[3-[[1-(2-anilino-2-oxoethyl)piperidin-4-yl]amino]-3-oxo-1-phenylpropyl]benzamide.
| Compound Name | N-[3-[[1-(2-anilino-2-oxoethyl)piperidin-4-yl]amino]-3-oxo-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 55518864 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[3-[[1-(2-anilino-2-oxoethyl)piperidin-4-yl]amino]-3-oxo-1-phenylpropyl]benzamide |
| SMILES | O=C(CN1CCC(NC(=O)CC(NC(=O)c2ccccc2)c2ccccc2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C29H32N4O3/c34-27(20-26(22-10-4-1-5-11-22)32-29(36)23-12-6-2-7-13-23)30-25-16-18-33(19-17-25)21-28(35)31-24-14-8-3-9-15-24/h1-15,25-26H,16-21H2,(H,30,34)(H,31,35)(H,32,36) |
| InChIKey | YGKDAZHRWIPETK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |