C21H25Cl2NO3 — CID 55520300
(2,2-dichloro-1-methylcyclopropyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone (PubChem CID 55520300) has the molecular formula C21H25Cl2NO3 and a molecular weight of 410.34 g/mol. Its IUPAC name is (2,2-dichloro-1-methylcyclopropyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone.
| Compound Name | (2,2-dichloro-1-methylcyclopropyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
|---|---|
| PubChem CID | 55520300 |
| Molecular Formula | C21H25Cl2NO3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2,2-dichloro-1-methylcyclopropyl)-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)C1(C)CC1(Cl)Cl)OCCO3 |
| InChI | InChI=1S/C21H25Cl2NO3/c1-13-14-9-16-17(27-8-7-26-16)10-15(14)20(5-3-4-6-20)12-24(13)18(25)19(2)11-21(19,22)23/h9-10,13H,3-8,11-12H2,1-2H3 |
| InChIKey | CXSMKHHCPSGDLK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|