C18H30N4O4 — CID 55520354
2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide (PubChem CID 55520354) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide |
|---|---|
| PubChem CID | 55520354 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide |
| SMILES | CC(C)C(CNC(=O)CN1C(=O)NC2(CCCC2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C18H30N4O4/c1-13(2)14(21-7-9-26-10-8-21)11-19-15(23)12-22-16(24)18(20-17(22)25)5-3-4-6-18/h13-14H,3-12H2,1-2H3,(H,19,23)(H,20,25) |
| InChIKey | SHLPHUOWWACDBR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|