About 3-phenyl-2,3-dihydro-1,2-oxazole
3-phenyl-2,3-dihydro-1,2-oxazole (PubChem CID 555206) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 3-phenyl-2,3-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-phenyl-2,3-dihydro-1,2-oxazole |
| PubChem CID | 555206 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 3-phenyl-2,3-dihydro-1,2-oxazole |
| SMILES | C1=CC(c2ccccc2)NO1 |
| InChI | InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-7-11-10-9/h1-7,9-10H |
| InChIKey | JCCHJWGKBDSWNJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-2,3-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,3-dihydro-1,2-oxazole?
The IUPAC name of 3-phenyl-2,3-dihydro-1,2-oxazole (CID 555206) is 3-phenyl-2,3-dihydro-1,2-oxazole.
What is the SMILES notation for 3-phenyl-2,3-dihydro-1,2-oxazole?
The canonical SMILES for 3-phenyl-2,3-dihydro-1,2-oxazole is C1=CC(c2ccccc2)NO1.
What is the InChIKey of 3-phenyl-2,3-dihydro-1,2-oxazole?
The InChIKey is JCCHJWGKBDSWNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-2-4-8(5-3-1)9-6-7-11-10-9/h1-7,9-10H.
What are the key properties of 3-phenyl-2,3-dihydro-1,2-oxazole?
3-phenyl-2,3-dihydro-1,2-oxazole has a molecular weight of 147.18 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,3-dihydro-1,2-oxazole is sourced from PubChem (CID 555206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).