C21H25ClF3N3O4 — CID 55520882
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 55520882) has the molecular formula C21H25ClF3N3O4 and a molecular weight of 475.90 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 55520882 |
| Molecular Formula | C21H25ClF3N3O4 |
| Molecular Weight | 475.90 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)Nc1cc(Cl)ccc1OCC(F)(F)F)C2=O |
| InChI | InChI=1S/C21H25ClF3N3O4/c1-12-7-19(2,3)10-20(8-12)17(30)28(18(31)27-20)9-16(29)26-14-6-13(22)4-5-15(14)32-11-21(23,24)25/h4-6,12H,7-11H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | RDWMXICBIPNGCP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|