C27H26N6OS — CID 55520996
N-[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55520996) has the molecular formula C27H26N6OS and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55520996 |
| Molecular Formula | C27H26N6OS |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-6-cyclopropyl-1,3-dimethylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C)c2nc(C3CC3)cc(C(=O)Nc3sc4c(c3-c3nc5ccccc5[nH]3)CCCC4)c12 |
| InChI | InChI=1S/C27H26N6OS/c1-14-22-17(13-20(15-11-12-15)30-25(22)33(2)32-14)26(34)31-27-23(16-7-3-6-10-21(16)35-27)24-28-18-8-4-5-9-19(18)29-24/h4-5,8-9,13,15H,3,6-7,10-12H2,1-2H3,(H,28,29)(H,31,34) |
| InChIKey | GHLZBCYGWBJRBI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |