C25H28N4O3 — CID 55523149
5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-[1-(2-methoxy-5-methylphenyl)ethyl]-4-oxopentanamide (PubChem CID 55523149) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-[1-(2-methoxy-5-methylphenyl)ethyl]-4-oxopentanamide.
| Compound Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-[1-(2-methoxy-5-methylphenyl)ethyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 55523149 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-N-[1-(2-methoxy-5-methylphenyl)ethyl]-4-oxopentanamide |
| SMILES | COc1ccc(C)cc1C(C)NC(=O)CCC(=O)C(C#N)=C1N(C)c2ccccc2N1C |
| InChI | InChI=1S/C25H28N4O3/c1-16-10-12-23(32-5)18(14-16)17(2)27-24(31)13-11-22(30)19(15-26)25-28(3)20-8-6-7-9-21(20)29(25)4/h6-10,12,14,17H,11,13H2,1-5H3,(H,27,31) |
| InChIKey | TZOSWXNHSWUDQX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|