C17H16INO4S — CID 55524730
[1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55524730) has the molecular formula C17H16INO4S and a molecular weight of 457.29 g/mol. Its IUPAC name is [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55524730 |
| Molecular Formula | C17H16INO4S |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | [1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc(I)o1)C(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C17H16INO4S/c1-11(22-16(20)5-3-13-2-4-15(18)23-13)17(21)19-8-6-14-12(10-19)7-9-24-14/h2-5,7,9,11H,6,8,10H2,1H3/b5-3+ |
| InChIKey | AVXXUGIDTCOZTQ-HWKANZROSA-N |
| XLogP | 3.48 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|