C15H19ClN4O2S — CID 55524999
2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide (PubChem CID 55524999) has the molecular formula C15H19ClN4O2S and a molecular weight of 354.86 g/mol. Its IUPAC name is 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 55524999 |
| Molecular Formula | C15H19ClN4O2S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Sc1nncn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN4O2S/c1-11(14(21)17-7-4-8-22-2)23-15-19-18-10-20(15)13-6-3-5-12(16)9-13/h3,5-6,9-11H,4,7-8H2,1-2H3,(H,17,21) |
| InChIKey | DIRXLJIOCKTDEA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|