C18H18ClF3N2O2 — CID 55525311
2-(5-chloroquinolin-8-yl)oxy-N-[3-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 55525311) has the molecular formula C18H18ClF3N2O2 and a molecular weight of 386.80 g/mol. Its IUPAC name is 2-(5-chloroquinolin-8-yl)oxy-N-[3-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-(5-chloroquinolin-8-yl)oxy-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 55525311 |
| Molecular Formula | C18H18ClF3N2O2 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-(5-chloroquinolin-8-yl)oxy-N-[3-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c2cccnc12)NC1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H18ClF3N2O2/c19-14-6-7-15(17-13(14)5-2-8-23-17)26-10-16(25)24-12-4-1-3-11(9-12)18(20,21)22/h2,5-8,11-12H,1,3-4,9-10H2,(H,24,25) |
| InChIKey | OOWDWMRTJDHYFD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |