C15H29N3O4S — CID 55526700
N-(3-methyl-2-morpholin-4-ylbutyl)-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 55526700) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(3-methyl-2-morpholin-4-ylbutyl)-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-(3-methyl-2-morpholin-4-ylbutyl)-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55526700 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(3-methyl-2-morpholin-4-ylbutyl)-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CC(C)C(CNC(=O)C1CCCN1S(C)(=O)=O)N1CCOCC1 |
| InChI | InChI=1S/C15H29N3O4S/c1-12(2)14(17-7-9-22-10-8-17)11-16-15(19)13-5-4-6-18(13)23(3,20)21/h12-14H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | UFBMSNMDFUFPSI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |