C17H24N6O2S — CID 55526730
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]acetamide (PubChem CID 55526730) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 55526730 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]acetamide |
| SMILES | O=C(CSc1nnnn1C1CC1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C17H24N6O2S/c24-16(12-26-17-19-20-21-23(17)13-6-7-13)18-11-14(15-5-4-10-25-15)22-8-2-1-3-9-22/h4-5,10,13-14H,1-3,6-9,11-12H2,(H,18,24) |
| InChIKey | GDIJUBCKWQIAHB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |