C9H9F5OSi — CID 555278
trimethyl-(2,3,4,5,6-pentafluorophenoxy)silane (PubChem CID 555278) has the molecular formula C9H9F5OSi and a molecular weight of 256.25 g/mol. Its IUPAC name is trimethyl-(2,3,4,5,6-pentafluorophenoxy)silane.
| Compound Name | trimethyl-(2,3,4,5,6-pentafluorophenoxy)silane |
|---|---|
| PubChem CID | 555278 |
| Molecular Formula | C9H9F5OSi |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | trimethyl-(2,3,4,5,6-pentafluorophenoxy)silane |
| SMILES | C[Si](C)(C)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H9F5OSi/c1-16(2,3)15-9-7(13)5(11)4(10)6(12)8(9)14/h1-3H3 |
| InChIKey | FYCOZPGUWKTYNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|