C22H23N5O2 — CID 55528836
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]prop-2-enamide (PubChem CID 55528836) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 55528836 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]prop-2-enamide |
| SMILES | Cc1nc(C2(NC(=O)/C=C/c3cn(CCC#N)c4ccccc34)CCCC2)no1 |
| InChI | InChI=1S/C22H23N5O2/c1-16-24-21(26-29-16)22(11-4-5-12-22)25-20(28)10-9-17-15-27(14-6-13-23)19-8-3-2-7-18(17)19/h2-3,7-10,15H,4-6,11-12,14H2,1H3,(H,25,28)/b10-9+ |
| InChIKey | OCZSTAZCIYFRRE-MDZDMXLPSA-N |
| XLogP | 3.85 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|