C21H17FN4O5S2 — CID 55529933
1-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate (PubChem CID 55529933) has the molecular formula C21H17FN4O5S2 and a molecular weight of 488.52 g/mol. Its IUPAC name is 1-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate.
| Compound Name | 1-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
|---|---|
| PubChem CID | 55529933 |
| Molecular Formula | C21H17FN4O5S2 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 1-[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl 2,2-dioxo-3,4-dihydro-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazole-8-carboxylate |
| SMILES | Cc1ccc(-c2noc(C(C)OC(=O)c3ccc4c(c3)SC3=NS(=O)(=O)CCN34)n2)cc1F |
| InChI | InChI=1S/C21H17FN4O5S2/c1-11-3-4-13(9-15(11)22)18-23-19(31-24-18)12(2)30-20(27)14-5-6-16-17(10-14)32-21-25-33(28,29)8-7-26(16)21/h3-6,9-10,12H,7-8H2,1-2H3 |
| InChIKey | GAIGUGRNZFNCDS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 114.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |