About 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide
2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide (PubChem CID 555301) has the molecular formula C10H10N4O2
and a molecular weight of 218.22 g/mol. Its IUPAC name is 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide |
| PubChem CID | 555301 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide |
| SMILES | O=C(COc1ccccc1)Nc1ncn[nH]1 |
| InChI | InChI=1S/C10H10N4O2/c15-9(13-10-11-7-12-14-10)6-16-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,12,13,14,15) |
| InChIKey | RDQSHWYUPMQDEX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide?
The IUPAC name of 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide (CID 555301) is 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide.
What is the SMILES notation for 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide?
The canonical SMILES for 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide is O=C(COc1ccccc1)Nc1ncn[nH]1.
What is the InChIKey of 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide?
The InChIKey is RDQSHWYUPMQDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2/c15-9(13-10-11-7-12-14-10)6-16-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,12,13,14,15).
What are the key properties of 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide?
2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide has a molecular weight of 218.22 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-N-(1H-1,2,4-triazol-5-yl)acetamide is sourced from PubChem (CID 555301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).