About 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide
5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide (PubChem CID 555325) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide |
| PubChem CID | 555325 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1n[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C15H12N4O2/c20-14(16-11-7-3-1-4-8-11)13-15(21)19(18-17-13)12-9-5-2-6-10-12/h1-10,18H,(H,16,20) |
| InChIKey | AABNMYGEWOGCMF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide?
The IUPAC name of 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide (CID 555325) is 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide.
What is the SMILES notation for 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide?
The canonical SMILES for 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide is O=C(Nc1ccccc1)c1n[nH]n(-c2ccccc2)c1=O.
What is the InChIKey of 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide?
The InChIKey is AABNMYGEWOGCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2/c20-14(16-11-7-3-1-4-8-11)13-15(21)19(18-17-13)12-9-5-2-6-10-12/h1-10,18H,(H,16,20).
What are the key properties of 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide?
5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide has a molecular weight of 280.29 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-N,1-diphenyl-2H-triazole-4-carboxamide is sourced from PubChem (CID 555325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).