C13H17NO — CID 555354
4,5-diethyl-2-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 555354) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 4,5-diethyl-2-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 4,5-diethyl-2-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 555354 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4,5-diethyl-2-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC1N=C(c2ccccc2)OC1CC |
| InChI | InChI=1S/C13H17NO/c1-3-11-12(4-2)15-13(14-11)10-8-6-5-7-9-10/h5-9,11-12H,3-4H2,1-2H3 |
| InChIKey | MSPVBNYZAASTPU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |