C21H24N2O6 — CID 55535745
[1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 55535745) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55535745 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | CCCCC(OC(=O)/C=C/c1ccc2c(c1)OCCO2)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C21H24N2O6/c1-3-4-5-17(21(25)22-19-12-14(2)29-23-19)28-20(24)9-7-15-6-8-16-18(13-15)27-11-10-26-16/h6-9,12-13,17H,3-5,10-11H2,1-2H3,(H,22,23,25)/b9-7+ |
| InChIKey | IUSSYBVOWKXLFM-VQHVLOKHSA-N |
| XLogP | 3.51 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|