C17H12FN3O5S — CID 55536910
(5-fluoro-2-nitrophenyl) 2-(furan-2-yl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylate (PubChem CID 55536910) has the molecular formula C17H12FN3O5S and a molecular weight of 389.36 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 2-(furan-2-yl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylate.
| Compound Name | (5-fluoro-2-nitrophenyl) 2-(furan-2-yl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55536910 |
| Molecular Formula | C17H12FN3O5S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 2-(furan-2-yl)-4-methyl-6-methylsulfanylpyrimidine-5-carboxylate |
| SMILES | CSc1nc(-c2ccco2)nc(C)c1C(=O)Oc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12FN3O5S/c1-9-14(16(27-2)20-15(19-9)12-4-3-7-25-12)17(22)26-13-8-10(18)5-6-11(13)21(23)24/h3-8H,1-2H3 |
| InChIKey | MZEIOAYEHKRCSN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|